C15H23Cl2N3O4 — CID 119840970
methyl 2-(3-aminopropanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 119840970) has the molecular formula C15H23Cl2N3O4 and a molecular weight of 380.27 g/mol. Its IUPAC name is methyl 2-(3-aminopropanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-(3-aminopropanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 119840970 |
| Molecular Formula | C15H23Cl2N3O4 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | methyl 2-(3-aminopropanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)CCN.Cl.Cl |
| InChI | InChI=1S/C15H21N3O4.2ClH/c1-21-15(20)12-10-11(18-6-8-22-9-7-18)2-3-13(12)17-14(19)4-5-16;;/h2-3,10H,4-9,16H2,1H3,(H,17,19);2*1H |
| InChIKey | YBLAAZSOCZHDBI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |