C19H31Cl2N3O4 — CID 119840926
methyl 2-(7-aminoheptanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 119840926) has the molecular formula C19H31Cl2N3O4 and a molecular weight of 436.38 g/mol. Its IUPAC name is methyl 2-(7-aminoheptanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-(7-aminoheptanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 119840926 |
| Molecular Formula | C19H31Cl2N3O4 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | methyl 2-(7-aminoheptanoylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)CCCCCCN.Cl.Cl |
| InChI | InChI=1S/C19H29N3O4.2ClH/c1-25-19(24)16-14-15(22-10-12-26-13-11-22)7-8-17(16)21-18(23)6-4-2-3-5-9-20;;/h7-8,14H,2-6,9-13,20H2,1H3,(H,21,23);2*1H |
| InChIKey | OSAVIDJKVAABLI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|