About methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate
methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate (PubChem CID 120797586) has the molecular formula C18H25N3O5
and a molecular weight of 363.41 g/mol. Its IUPAC name is methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate.
Molecular Properties
| Compound Name | methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate |
| PubChem CID | 120797586 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)[C@@H]1CC[C@H](CN)O1 |
| InChI | InChI=1S/C18H25N3O5/c1-24-18(23)14-10-12(21-6-8-25-9-7-21)2-4-15(14)20-17(22)16-5-3-13(11-19)26-16/h2,4,10,13,16H,3,5-9,11,19H2,1H3,(H,20,22)/t13-,16+/m1/s1 |
| InChIKey | VJYDLFLZAZPFFG-CJNGLKHVSA-N |
| XLogP | 0.75 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate?
The IUPAC name of methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate (CID 120797586) is methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate.
What is the SMILES notation for methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate?
The canonical SMILES for methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate is COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)[C@@H]1CC[C@H](CN)O1.
What is the InChIKey of methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate?
The InChIKey is VJYDLFLZAZPFFG-CJNGLKHVSA-N. The full InChI is InChI=1S/C18H25N3O5/c1-24-18(23)14-10-12(21-6-8-25-9-7-21)2-4-15(14)20-17(22)16-5-3-13(11-19)26-16/h2,4,10,13,16H,3,5-9,11,19H2,1H3,(H,20,22)/t13-,16+/m1/s1.
What are the key properties of methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate?
methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate has a molecular weight of 363.41 g/mol, XLogP of 0.75, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(2S,5R)-5-(aminomethyl)oxolane-2-carbonyl]amino]-5-morpholin-4-ylbenzoate is sourced from PubChem (CID 120797586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).