About methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride
methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride (PubChem CID 119840974) has the molecular formula C17H25Cl2N3O4
and a molecular weight of 406.31 g/mol. Its IUPAC name is methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride |
| PubChem CID | 119840974 |
| Molecular Formula | C17H25Cl2N3O4 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)C1CCNC1.Cl.Cl |
| InChI | InChI=1S/C17H23N3O4.2ClH/c1-23-17(22)14-10-13(20-6-8-24-9-7-20)2-3-15(14)19-16(21)12-4-5-18-11-12;;/h2-3,10,12,18H,4-9,11H2,1H3,(H,19,21);2*1H |
| InChIKey | SADRDEVEKYKTPH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride?
The IUPAC name of methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride (CID 119840974) is methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride.
What is the SMILES notation for methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride?
The canonical SMILES for methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride is COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)C1CCNC1.Cl.Cl.
What is the InChIKey of methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride?
The InChIKey is SADRDEVEKYKTPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O4.2ClH/c1-23-17(22)14-10-13(20-6-8-24-9-7-20)2-3-15(14)19-16(21)12-4-5-18-11-12;;/h2-3,10,12,18H,4-9,11H2,1H3,(H,19,21);2*1H.
What are the key properties of methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride?
methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride has a molecular weight of 406.31 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-morpholin-4-yl-2-(pyrrolidine-3-carbonylamino)benzoate;dihydrochloride is sourced from PubChem (CID 119840974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).