C17H25Cl2N3O5 — CID 119840964
methyl 2-(morpholine-2-carbonylamino)-5-morpholin-4-ylbenzoate;dihydrochloride (PubChem CID 119840964) has the molecular formula C17H25Cl2N3O5 and a molecular weight of 422.31 g/mol. Its IUPAC name is methyl 2-(morpholine-2-carbonylamino)-5-morpholin-4-ylbenzoate;dihydrochloride.
| Compound Name | methyl 2-(morpholine-2-carbonylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
|---|---|
| PubChem CID | 119840964 |
| Molecular Formula | C17H25Cl2N3O5 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | methyl 2-(morpholine-2-carbonylamino)-5-morpholin-4-ylbenzoate;dihydrochloride |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)C1CNCCO1.Cl.Cl |
| InChI | InChI=1S/C17H23N3O5.2ClH/c1-23-17(22)13-10-12(20-5-8-24-9-6-20)2-3-14(13)19-16(21)15-11-18-4-7-25-15;;/h2-3,10,15,18H,4-9,11H2,1H3,(H,19,21);2*1H |
| InChIKey | FXXFLILLSWIOLH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |