C15H22Cl2FN3O3 — CID 119871805
N-(3-fluoro-5-morpholin-4-ylphenyl)morpholine-2-carboxamide;dihydrochloride (PubChem CID 119871805) has the molecular formula C15H22Cl2FN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is N-(3-fluoro-5-morpholin-4-ylphenyl)morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-(3-fluoro-5-morpholin-4-ylphenyl)morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119871805 |
| Molecular Formula | C15H22Cl2FN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-(3-fluoro-5-morpholin-4-ylphenyl)morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1cc(F)cc(N2CCOCC2)c1)C1CNCCO1 |
| InChI | InChI=1S/C15H20FN3O3.2ClH/c16-11-7-12(18-15(20)14-10-17-1-4-22-14)9-13(8-11)19-2-5-21-6-3-19;;/h7-9,14,17H,1-6,10H2,(H,18,20);2*1H |
| InChIKey | PLDRSUOFTWCLLC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |