C15H20FN3O5S — CID 119679004
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)morpholine-2-carboxamide (PubChem CID 119679004) has the molecular formula C15H20FN3O5S and a molecular weight of 373.41 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)morpholine-2-carboxamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119679004 |
| Molecular Formula | C15H20FN3O5S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)morpholine-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)C1CNCCO1 |
| InChI | InChI=1S/C15H20FN3O5S/c16-12-2-1-11(18-15(20)13-10-17-3-6-24-13)9-14(12)25(21,22)19-4-7-23-8-5-19/h1-2,9,13,17H,3-8,10H2,(H,18,20) |
| InChIKey | MHOYGQHYXJAOET-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |