C15H15FN2O5S — CID 51154323
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide (PubChem CID 51154323) has the molecular formula C15H15FN2O5S and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51154323 |
| Molecular Formula | C15H15FN2O5S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1ccco1 |
| InChI | InChI=1S/C15H15FN2O5S/c16-12-4-3-11(17-15(19)13-2-1-7-23-13)10-14(12)24(20,21)18-5-8-22-9-6-18/h1-4,7,10H,5-6,8-9H2,(H,17,19) |
| InChIKey | BIZGUSIOTODHLD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |