C24H22F2N2O5S — CID 26206760
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 26206760) has the molecular formula C24H22F2N2O5S and a molecular weight of 488.51 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 26206760 |
| Molecular Formula | C24H22F2N2O5S |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H22F2N2O5S/c25-18-7-5-17(6-8-18)16-33-22-4-2-1-3-20(22)24(29)27-19-9-10-21(26)23(15-19)34(30,31)28-11-13-32-14-12-28/h1-10,15H,11-14,16H2,(H,27,29) |
| InChIKey | QRJMXGIPFNVLRE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |