C20H23FN2O7S — CID 55341413
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2,4,5-trimethoxybenzamide (PubChem CID 55341413) has the molecular formula C20H23FN2O7S and a molecular weight of 454.48 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55341413 |
| Molecular Formula | C20H23FN2O7S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)cc1OC |
| InChI | InChI=1S/C20H23FN2O7S/c1-27-16-12-18(29-3)17(28-2)11-14(16)20(24)22-13-4-5-15(21)19(10-13)31(25,26)23-6-8-30-9-7-23/h4-5,10-12H,6-9H2,1-3H3,(H,22,24) |
| InChIKey | LJVILMZVVZWQSG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |