C24H24FN3O5S — CID 4885170
2-(4-fluoroanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 4885170) has the molecular formula C24H24FN3O5S and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 2-(4-fluoroanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4885170 |
| Molecular Formula | C24H24FN3O5S |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-(4-fluoroanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2Nc2ccc(F)cc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H24FN3O5S/c1-32-22-11-10-19(16-23(22)34(30,31)28-12-14-33-15-13-28)27-24(29)20-4-2-3-5-21(20)26-18-8-6-17(25)7-9-18/h2-11,16,26H,12-15H2,1H3,(H,27,29) |
| InChIKey | LUEADTJUUZYQND-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |