C23H29N3O7S2 — CID 100679263
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide (PubChem CID 100679263) has the molecular formula C23H29N3O7S2 and a molecular weight of 523.63 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 100679263 |
| Molecular Formula | C23H29N3O7S2 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-4-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C23H29N3O7S2/c1-32-21-10-7-19(17-22(21)35(30,31)25-11-3-2-4-12-25)24-23(27)18-5-8-20(9-6-18)34(28,29)26-13-15-33-16-14-26/h5-10,17H,2-4,11-16H2,1H3,(H,24,27) |
| InChIKey | SLAGEJZRECTBRD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |