C22H27N3O7S2 — CID 5058872
4-methoxy-3-morpholin-4-ylsulfonyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 5058872) has the molecular formula C22H27N3O7S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-methoxy-3-morpholin-4-ylsulfonyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-methoxy-3-morpholin-4-ylsulfonyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 5058872 |
| Molecular Formula | C22H27N3O7S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 4-methoxy-3-morpholin-4-ylsulfonyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O7S2/c1-31-20-8-7-17(15-21(20)34(29,30)25-11-13-32-14-12-25)22(26)23-18-5-4-6-19(16-18)33(27,28)24-9-2-3-10-24/h4-8,15-16H,2-3,9-14H2,1H3,(H,23,26) |
| InChIKey | SAESWUGYDGYBKD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |