C18H21N3O5S — CID 8890703
N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 8890703) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 8890703 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc[n+]([O-])cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H21N3O5S/c1-26-16-6-5-15(19-18(22)14-7-11-20(23)12-8-14)13-17(16)27(24,25)21-9-3-2-4-10-21/h5-8,11-13H,2-4,9-10H2,1H3,(H,19,22) |
| InChIKey | DOGURVOLRWYQDA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|