C19H21IN2O4S — CID 18892179
N-(4-iodophenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 18892179) has the molecular formula C19H21IN2O4S and a molecular weight of 500.36 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-iodophenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 18892179 |
| Molecular Formula | C19H21IN2O4S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | N-(4-iodophenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(I)cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H21IN2O4S/c1-26-17-10-5-14(19(23)21-16-8-6-15(20)7-9-16)13-18(17)27(24,25)22-11-3-2-4-12-22/h5-10,13H,2-4,11-12H2,1H3,(H,21,23) |
| InChIKey | ZLJNQLZXBGPONC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|