C21H25ClN2O6S — CID 18892263
N-(4-chloro-2,5-dimethoxyphenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 18892263) has the molecular formula C21H25ClN2O6S and a molecular weight of 468.96 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 18892263 |
| Molecular Formula | C21H25ClN2O6S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-4-methoxy-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | COc1cc(NC(=O)c2ccc(OC)c(S(=O)(=O)N3CCCCC3)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C21H25ClN2O6S/c1-28-17-8-7-14(11-20(17)31(26,27)24-9-5-4-6-10-24)21(25)23-16-13-18(29-2)15(22)12-19(16)30-3/h7-8,11-13H,4-6,9-10H2,1-3H3,(H,23,25) |
| InChIKey | GRYIRQFBFQVGKK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |