C21H19FN4O4S — CID 75400675
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-4-phenylpyrimidine-5-carboxamide (PubChem CID 75400675) has the molecular formula C21H19FN4O4S and a molecular weight of 442.47 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-4-phenylpyrimidine-5-carboxamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-4-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 75400675 |
| Molecular Formula | C21H19FN4O4S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-4-phenylpyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1cncnc1-c1ccccc1 |
| InChI | InChI=1S/C21H19FN4O4S/c22-18-7-6-16(12-19(18)31(28,29)26-8-10-30-11-9-26)25-21(27)17-13-23-14-24-20(17)15-4-2-1-3-5-15/h1-7,12-14H,8-11H2,(H,25,27) |
| InChIKey | ISJWYSYDGXRSII-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |