C24H20FN3O4S2 — CID 17431718
N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 17431718) has the molecular formula C24H20FN3O4S2 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17431718 |
| Molecular Formula | C24H20FN3O4S2 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)N2CCOCC2)c1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C24H20FN3O4S2/c25-19-8-7-16(14-23(19)34(30,31)28-9-11-32-12-10-28)26-24(29)18-15-21(22-6-3-13-33-22)27-20-5-2-1-4-17(18)20/h1-8,13-15H,9-12H2,(H,26,29) |
| InChIKey | KDNVIKGTPZLSRS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |