C20H15N3O3S2 — CID 3368053
N-(4-sulfamoylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 3368053) has the molecular formula C20H15N3O3S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3368053 |
| Molecular Formula | C20H15N3O3S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cc(-c3cccs3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C20H15N3O3S2/c21-28(25,26)14-9-7-13(8-10-14)22-20(24)16-12-18(19-6-3-11-27-19)23-17-5-2-1-4-15(16)17/h1-12H,(H,22,24)(H2,21,25,26) |
| InChIKey | ROTUDRXMXAXNGS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |