C23H15N3OS2 — CID 2313908
N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 2313908) has the molecular formula C23H15N3OS2 and a molecular weight of 413.53 g/mol. Its IUPAC name is N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2313908 |
| Molecular Formula | C23H15N3OS2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-(4-phenyl-1,3-thiazol-2-yl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C23H15N3OS2/c27-22(26-23-25-20(14-29-23)15-7-2-1-3-8-15)17-13-19(21-11-6-12-28-21)24-18-10-5-4-9-16(17)18/h1-14H,(H,25,26,27) |
| InChIKey | MXGHLZQIXMEFAY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |