C20H15N5O3S2 — CID 43070381
N-[4-[[(2-thiophen-2-ylquinoline-4-carbonyl)amino]carbamoyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 43070381) has the molecular formula C20H15N5O3S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is N-[4-[[(2-thiophen-2-ylquinoline-4-carbonyl)amino]carbamoyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[[(2-thiophen-2-ylquinoline-4-carbonyl)amino]carbamoyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43070381 |
| Molecular Formula | C20H15N5O3S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N-[4-[[(2-thiophen-2-ylquinoline-4-carbonyl)amino]carbamoyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C(=O)NNC(=O)c2cc(-c3cccs3)nc3ccccc23)cs1 |
| InChI | InChI=1S/C20H15N5O3S2/c1-11(26)21-20-23-16(10-30-20)19(28)25-24-18(27)13-9-15(17-7-4-8-29-17)22-14-6-3-2-5-12(13)14/h2-10H,1H3,(H,24,27)(H,25,28)(H,21,23,26) |
| InChIKey | FQGDYTSTOKAIKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|