C20H15N3OS — CID 78774952
N'-phenyl-2-thiophen-2-ylquinoline-4-carbohydrazide (PubChem CID 78774952) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is N'-phenyl-2-thiophen-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-phenyl-2-thiophen-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 78774952 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N'-phenyl-2-thiophen-2-ylquinoline-4-carbohydrazide |
| SMILES | O=C(NNc1ccccc1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H15N3OS/c24-20(23-22-14-7-2-1-3-8-14)16-13-18(19-11-6-12-25-19)21-17-10-5-4-9-15(16)17/h1-13,22H,(H,23,24) |
| InChIKey | VKWQAULOBRBVRV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|