C23H19N3O3S — CID 31835498
N'-[2-(4-methoxyphenyl)acetyl]-2-thiophen-2-ylquinoline-4-carbohydrazide (PubChem CID 31835498) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is N'-[2-(4-methoxyphenyl)acetyl]-2-thiophen-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[2-(4-methoxyphenyl)acetyl]-2-thiophen-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 31835498 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N'-[2-(4-methoxyphenyl)acetyl]-2-thiophen-2-ylquinoline-4-carbohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cc(-c3cccs3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H19N3O3S/c1-29-16-10-8-15(9-11-16)13-22(27)25-26-23(28)18-14-20(21-7-4-12-30-21)24-19-6-3-2-5-17(18)19/h2-12,14H,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | QMYVCMNBPALSGR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|