C29H31N3O2S — CID 146025289
N-[2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 146025289) has the molecular formula C29H31N3O2S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 146025289 |
| Molecular Formula | C29H31N3O2S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-(4-methoxyphenyl)ethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)c2cc(-c3cccs3)nc3ccccc23)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C29H31N3O2S/c1-34-22-14-12-21(13-15-22)27(32-16-6-2-3-7-17-32)20-30-29(33)24-19-26(28-11-8-18-35-28)31-25-10-5-4-9-23(24)25/h4-5,8-15,18-19,27H,2-3,6-7,16-17,20H2,1H3,(H,30,33) |
| InChIKey | HDGUPHIYUVPTBF-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |