C27H26N4O — CID 24619664
N-(2-phenyl-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 24619664) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(2-phenyl-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-(2-phenyl-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 24619664 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-(2-phenyl-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)N1CCCC1)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C27H26N4O/c32-27(29-19-26(31-16-8-9-17-31)20-10-2-1-3-11-20)22-18-25(24-14-6-7-15-28-24)30-23-13-5-4-12-21(22)23/h1-7,10-15,18,26H,8-9,16-17,19H2,(H,29,32) |
| InChIKey | OYENTDDOSGQXPG-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |