C25H24N4O2S — CID 5136979
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide (PubChem CID 5136979) has the molecular formula C25H24N4O2S and a molecular weight of 444.56 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 5136979 |
| Molecular Formula | C25H24N4O2S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-pyridin-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)c1cc(-c2ccccn2)nc2ccccc12 |
| InChI | InChI=1S/C25H24N4O2S/c30-25(27-17-23(24-9-5-15-32-24)29-11-13-31-14-12-29)19-16-22(21-8-3-4-10-26-21)28-20-7-2-1-6-18(19)20/h1-10,15-16,23H,11-14,17H2,(H,27,30) |
| InChIKey | ACOAKUOXTNKEJD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |