C24H23N3O2S2 — CID 2395138
N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 2395138) has the molecular formula C24H23N3O2S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide.
| Compound Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 2395138 |
| Molecular Formula | C24H23N3O2S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCOCC1)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C24H23N3O2S2/c28-24(25-16-21(23-8-4-14-31-23)27-9-11-29-12-10-27)18-15-20(22-7-3-13-30-22)26-19-6-2-1-5-17(18)19/h1-8,13-15,21H,9-12,16H2,(H,25,28)/t21-/m1/s1 |
| InChIKey | BPERLEJQOVBZRV-OAQYLSRUSA-N |
| XLogP | 4.83 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |