C17H18ClFN2O2S — CID 18148637
5-chloro-2-fluoro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 18148637) has the molecular formula C17H18ClFN2O2S and a molecular weight of 368.86 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 5-chloro-2-fluoro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 18148637 |
| Molecular Formula | C17H18ClFN2O2S |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-chloro-2-fluoro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCOCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C17H18ClFN2O2S/c18-12-3-4-14(19)13(10-12)17(22)20-11-15(16-2-1-9-24-16)21-5-7-23-8-6-21/h1-4,9-10,15H,5-8,11H2,(H,20,22) |
| InChIKey | RQIDRKLEKKYKKB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |