C17H22Cl3N3O2S — CID 119829185
4-amino-2-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride (PubChem CID 119829185) has the molecular formula C17H22Cl3N3O2S and a molecular weight of 438.81 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride.
| Compound Name | 4-amino-2-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119829185 |
| Molecular Formula | C17H22Cl3N3O2S |
| Molecular Weight | 438.81 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 4-amino-2-chloro-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(C(=O)NCC(c2cccs2)N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H20ClN3O2S.2ClH/c18-14-10-12(19)3-4-13(14)17(22)20-11-15(16-2-1-9-24-16)21-5-7-23-8-6-21;;/h1-4,9-10,15H,5-8,11,19H2,(H,20,22);2*1H |
| InChIKey | FQKOSPZWQRRFIH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|