C16H17Cl2N3O2S — CID 2509986
5,6-dichloro-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyridine-3-carboxamide (PubChem CID 2509986) has the molecular formula C16H17Cl2N3O2S and a molecular weight of 386.30 g/mol. Its IUPAC name is 5,6-dichloro-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2509986 |
| Molecular Formula | C16H17Cl2N3O2S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 5,6-dichloro-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCOCC1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H17Cl2N3O2S/c17-12-8-11(9-19-15(12)18)16(22)20-10-13(14-2-1-7-24-14)21-3-5-23-6-4-21/h1-2,7-9,13H,3-6,10H2,(H,20,22)/t13-/m0/s1 |
| InChIKey | IGIFRMJKNOUBCT-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|