C16H19N3O3S — CID 94180353
N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 94180353) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 94180353 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCOCC1)c1ccc[nH]c1=O |
| InChI | InChI=1S/C16H19N3O3S/c20-15-12(3-1-5-17-15)16(21)18-11-13(14-4-2-10-23-14)19-6-8-22-9-7-19/h1-5,10,13H,6-9,11H2,(H,17,20)(H,18,21)/t13-/m1/s1 |
| InChIKey | SMEVBFXBQHJCAW-CYBMUJFWSA-N |
| XLogP | 1.24 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |