C15H17BrN2O2S2 — CID 37099503
5-bromo-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]thiophene-2-carboxamide (PubChem CID 37099503) has the molecular formula C15H17BrN2O2S2 and a molecular weight of 401.35 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 37099503 |
| Molecular Formula | C15H17BrN2O2S2 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 5-bromo-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCOCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H17BrN2O2S2/c16-14-4-3-13(22-14)15(19)17-10-11(12-2-1-9-21-12)18-5-7-20-8-6-18/h1-4,9,11H,5-8,10H2,(H,17,19)/t11-/m1/s1 |
| InChIKey | XINDQEXYRWVGOL-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |