C17H23BrN4OS2 — CID 111283795
1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283795) has the molecular formula C17H23BrN4OS2 and a molecular weight of 443.44 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283795 |
| Molecular Formula | C17H23BrN4OS2 |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCc1ccc(Br)s1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H23BrN4OS2/c1-19-17(20-11-13-4-5-16(18)25-13)21-12-14(15-3-2-10-24-15)22-6-8-23-9-7-22/h2-5,10,14H,6-9,11-12H2,1H3,(H2,19,20,21) |
| InChIKey | AGYPLLXUJWLBLV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|