C18H28N6OS2 — CID 111964725
1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111964725) has the molecular formula C18H28N6OS2 and a molecular weight of 408.60 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111964725 |
| Molecular Formula | C18H28N6OS2 |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[[2-(dimethylamino)-1,3-thiazol-4-yl]methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCc1csc(N(C)C)n1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C18H28N6OS2/c1-19-17(20-11-14-13-27-18(22-14)23(2)3)21-12-15(16-5-4-10-26-16)24-6-8-25-9-7-24/h4-5,10,13,15H,6-9,11-12H2,1-3H3,(H2,19,20,21) |
| InChIKey | IDMIHYYLWFDONC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|