C19H30N6OS — CID 111783891
2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111783891) has the molecular formula C19H30N6OS and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111783891 |
| Molecular Formula | C19H30N6OS |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1c(C)nn(C)c1C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C19H30N6OS/c1-14-16(15(2)24(4)23-14)12-21-19(20-3)22-13-17(18-6-5-11-27-18)25-7-9-26-10-8-25/h5-6,11,17H,7-10,12-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | UXATWPXBMJRGPW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|