C18H28IN5OS2 — CID 111514277
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111514277) has the molecular formula C18H28IN5OS2 and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111514277 |
| Molecular Formula | C18H28IN5OS2 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)NCC(c2cccs2)N2CCOCC2)s1.I |
| InChI | InChI=1S/C18H27N5OS2.HI/c1-3-14-11-20-17(26-14)13-22-18(19-2)21-12-15(16-5-4-10-25-16)23-6-8-24-9-7-23;/h4-5,10-11,15H,3,6-9,12-13H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | FUPKEIRHRCJQJS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|