C20H31IN6S — CID 109401032
1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 109401032) has the molecular formula C20H31IN6S and a molecular weight of 514.48 g/mol. Its IUPAC name is 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109401032 |
| Molecular Formula | C20H31IN6S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[[6-(dimethylamino)-2-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cccc(N(C)C)n1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C20H30N6S.HI/c1-21-20(22-14-16-8-6-10-19(24-16)25(2)3)23-15-17(18-9-7-13-27-18)26-11-4-5-12-26;/h6-10,13,17H,4-5,11-12,14-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | SZTXXLILFQFKJI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|