C18H28IN5S2 — CID 111771615
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111771615) has the molecular formula C18H28IN5S2 and a molecular weight of 505.50 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111771615 |
| Molecular Formula | C18H28IN5S2 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nc(C)c(C)s1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C18H27N5S2.HI/c1-13-14(2)25-17(22-13)12-21-18(19-3)20-11-15(16-7-6-10-24-16)23-8-4-5-9-23;/h6-7,10,15H,4-5,8-9,11-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | UVTHFTWTTXUZNL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|