C21H31N5OS — CID 111775030
1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine (PubChem CID 111775030) has the molecular formula C21H31N5OS and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111775030 |
| Molecular Formula | C21H31N5OS |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-3-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1nc(C)c(C)s1)NCC(c1ccccc1OC)N1CCCC1 |
| InChI | InChI=1S/C21H31N5OS/c1-15-16(2)28-20(25-15)14-24-21(22-3)23-13-18(26-11-7-8-12-26)17-9-5-6-10-19(17)27-4/h5-6,9-10,18H,7-8,11-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | HIIRKISHFYPWJV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|