C22H27N5S — CID 111968237
2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-(quinolin-4-ylmethyl)guanidine (PubChem CID 111968237) has the molecular formula C22H27N5S and a molecular weight of 393.56 g/mol. Its IUPAC name is 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-(quinolin-4-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-(quinolin-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111968237 |
| Molecular Formula | C22H27N5S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-methyl-1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-(quinolin-4-ylmethyl)guanidine |
| SMILES | C/N=C(/NCc1ccnc2ccccc12)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C22H27N5S/c1-23-22(25-15-17-10-11-24-19-8-3-2-7-18(17)19)26-16-20(21-9-6-14-28-21)27-12-4-5-13-27/h2-3,6-11,14,20H,4-5,12-13,15-16H2,1H3,(H2,23,25,26) |
| InChIKey | CTLIIFZGHABZSV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|