C22H31N5OS — CID 111760051
1-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111760051) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 1-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111760051 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[[2-(cyclopropylmethoxy)-4-pyridinyl]methyl]-2-methyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccnc(OCC2CC2)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C22H31N5OS/c1-23-22(25-14-18-8-9-24-21(13-18)28-16-17-6-7-17)26-15-19(20-5-4-12-29-20)27-10-2-3-11-27/h4-5,8-9,12-13,17,19H,2-3,6-7,10-11,14-16H2,1H3,(H2,23,25,26) |
| InChIKey | ZYHYAPGVVBJXPY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|