C23H32IN7S — CID 111323543
2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide (PubChem CID 111323543) has the molecular formula C23H32IN7S and a molecular weight of 565.53 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111323543 |
| Molecular Formula | C23H32IN7S |
| Molecular Weight | 565.53 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(-n2cccn2)c1)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C23H31N7S.HI/c1-18-7-12-29(13-8-18)20(21-5-3-14-31-21)17-27-23(24-2)26-16-19-6-10-25-22(15-19)30-11-4-9-28-30;/h3-6,9-11,14-15,18,20H,7-8,12-13,16-17H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | STMJSZOKUXVRTA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|