C22H32N4O2S2 — CID 111323394
2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(4-methylsulfonylphenyl)methyl]guanidine (PubChem CID 111323394) has the molecular formula C22H32N4O2S2 and a molecular weight of 448.66 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(4-methylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(4-methylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111323394 |
| Molecular Formula | C22H32N4O2S2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-[(4-methylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(C)(=O)=O)cc1)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H32N4O2S2/c1-17-10-12-26(13-11-17)20(21-5-4-14-29-21)16-25-22(23-2)24-15-18-6-8-19(9-7-18)30(3,27)28/h4-9,14,17,20H,10-13,15-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | MKMSVPIUPPVVLI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|