C24H36IN5OS — CID 111323441
N,N-dimethyl-4-[[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111323441) has the molecular formula C24H36IN5OS and a molecular weight of 569.56 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111323441 |
| Molecular Formula | C24H36IN5OS |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C(=O)N(C)C)cc1)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C24H35N5OS.HI/c1-18-11-13-29(14-12-18)21(22-6-5-15-31-22)17-27-24(25-2)26-16-19-7-9-20(10-8-19)23(30)28(3)4;/h5-10,15,18,21H,11-14,16-17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | BESDUNQVMJVLFI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|