C21H38N4O2S2 — CID 111635027
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111635027) has the molecular formula C21H38N4O2S2 and a molecular weight of 442.70 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111635027 |
| Molecular Formula | C21H38N4O2S2 |
| Molecular Weight | 442.70 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | C/N=C(/NCC(c1cccs1)N1CCC(C)CC1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C21H38N4O2S2/c1-17-8-11-25(12-9-17)18(19-7-6-13-28-19)15-23-20(22-4)24-16-21(2,3)10-14-29(5,26)27/h6-7,13,17-18H,8-12,14-16H2,1-5H3,(H2,22,23,24) |
| InChIKey | BRYDTHHMHPMMKR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|