C22H31N5OS — CID 111323250
2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]-N-phenylacetamide (PubChem CID 111323250) has the molecular formula C22H31N5OS and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]-N-phenylacetamide.
| Compound Name | 2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111323250 |
| Molecular Formula | C22H31N5OS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-[[N'-methyl-N-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]carbamimidoyl]amino]-N-phenylacetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccccc1)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C22H31N5OS/c1-17-10-12-27(13-11-17)19(20-9-6-14-29-20)15-24-22(23-2)25-16-21(28)26-18-7-4-3-5-8-18/h3-9,14,17,19H,10-13,15-16H2,1-2H3,(H,26,28)(H2,23,24,25) |
| InChIKey | IGFIAMXRTOARRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|