C20H34IN5OS — CID 111012024
N-cyclohexyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111012024) has the molecular formula C20H34IN5OS and a molecular weight of 519.50 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-cyclohexyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111012024 |
| Molecular Formula | C20H34IN5OS |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | N-cyclohexyl-2-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)NC1CCCCC1)NCC(c1cccs1)N1CCCC1.I |
| InChI | InChI=1S/C20H33N5OS.HI/c1-21-20(23-15-19(26)24-16-8-3-2-4-9-16)22-14-17(18-10-7-13-27-18)25-11-5-6-12-25;/h7,10,13,16-17H,2-6,8-9,11-12,14-15H2,1H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | HAWSZDVGKWOKPU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|