C21H34N4O2S — CID 134057481
4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide (PubChem CID 134057481) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 134057481 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H34N4O2S/c26-20(11-6-12-22-21(27)24-17-8-2-1-3-9-17)23-16-18(19-10-7-15-28-19)25-13-4-5-14-25/h7,10,15,17-18H,1-6,8-9,11-14,16H2,(H,23,26)(H2,22,24,27) |
| InChIKey | BIMRMIHCJYUAIF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|