C23H35ClN4O3 — CID 52506860
N-[(2S)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 52506860) has the molecular formula C23H35ClN4O3 and a molecular weight of 451.01 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-[(2S)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 52506860 |
| Molecular Formula | C23H35ClN4O3 |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)NC[C@H](c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H35ClN4O3/c24-19-10-8-18(9-11-19)21(28-13-15-31-16-14-28)17-26-22(29)7-4-12-25-23(30)27-20-5-2-1-3-6-20/h8-11,20-21H,1-7,12-17H2,(H,26,29)(H2,25,27,30)/t21-/m1/s1 |
| InChIKey | OCDNCZLXPROMLJ-OAQYLSRUSA-N |
| XLogP | 3.24 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|