C17H26ClN3O2 — CID 110621889
1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpropyl)urea (PubChem CID 110621889) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 110621889 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H26ClN3O2/c1-13(2)11-19-17(22)20-12-16(21-7-9-23-10-8-21)14-3-5-15(18)6-4-14/h3-6,13,16H,7-12H2,1-2H3,(H2,19,20,22) |
| InChIKey | FPMFBIXVDSFHEW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |